C19H17ClN6OS — CID 9088040
1-[[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]amino]-3-(3-chlorophenyl)thiourea (PubChem CID 9088040) has the molecular formula C19H17ClN6OS and a molecular weight of 412.91 g/mol. Its IUPAC name is 1-[[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]amino]-3-(3-chlorophenyl)thiourea.
| Compound Name | 1-[[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]amino]-3-(3-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 9088040 |
| Molecular Formula | C19H17ClN6OS |
| Molecular Weight | 412.91 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 1-[[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]amino]-3-(3-chlorophenyl)thiourea |
| SMILES | O=C(/C=C/c1cn(Cc2ccccc2)nn1)NNC(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H17ClN6OS/c20-15-7-4-8-16(11-15)21-19(28)24-23-18(27)10-9-17-13-26(25-22-17)12-14-5-2-1-3-6-14/h1-11,13H,12H2,(H,23,27)(H2,21,24,28)/b10-9+ |
| InChIKey | XRJNCTQPRVMUGO-MDZDMXLPSA-N |
| XLogP | 3.01 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.91 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|