C23H26N6O2 — CID 8968723
N'-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]-4-(diethylamino)benzohydrazide (PubChem CID 8968723) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is N'-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]-4-(diethylamino)benzohydrazide.
| Compound Name | N'-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]-4-(diethylamino)benzohydrazide |
|---|---|
| PubChem CID | 8968723 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | N'-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]-4-(diethylamino)benzohydrazide |
| SMILES | CCN(CC)c1ccc(C(=O)NNC(=O)/C=C/c2cn(Cc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C23H26N6O2/c1-3-28(4-2)21-13-10-19(11-14-21)23(31)26-25-22(30)15-12-20-17-29(27-24-20)16-18-8-6-5-7-9-18/h5-15,17H,3-4,16H2,1-2H3,(H,25,30)(H,26,31)/b15-12+ |
| InChIKey | DNMBQPCFSJIZMU-NTCAYCPXSA-N |
| XLogP | 2.65 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|