C17H21N5O3 — CID 166251293
2-[4-[(2-oxopiperidin-1-yl)methyl]triazol-1-yl]-N-phenylmethoxyacetamide (PubChem CID 166251293) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 2-[4-[(2-oxopiperidin-1-yl)methyl]triazol-1-yl]-N-phenylmethoxyacetamide.
| Compound Name | 2-[4-[(2-oxopiperidin-1-yl)methyl]triazol-1-yl]-N-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 166251293 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-[4-[(2-oxopiperidin-1-yl)methyl]triazol-1-yl]-N-phenylmethoxyacetamide |
| SMILES | O=C(Cn1cc(CN2CCCCC2=O)nn1)NOCc1ccccc1 |
| InChI | InChI=1S/C17H21N5O3/c23-16(19-25-13-14-6-2-1-3-7-14)12-22-11-15(18-20-22)10-21-9-5-4-8-17(21)24/h1-3,6-7,11H,4-5,8-10,12-13H2,(H,19,23) |
| InChIKey | DPADKKGBHCRSLD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|