C16H21N3O5S — CID 9218921
4-methylsulfonyl-N'-[2-(2-oxoazepan-1-yl)acetyl]benzohydrazide (PubChem CID 9218921) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is 4-methylsulfonyl-N'-[2-(2-oxoazepan-1-yl)acetyl]benzohydrazide.
| Compound Name | 4-methylsulfonyl-N'-[2-(2-oxoazepan-1-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 9218921 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 4-methylsulfonyl-N'-[2-(2-oxoazepan-1-yl)acetyl]benzohydrazide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NNC(=O)CN2CCCCCC2=O)cc1 |
| InChI | InChI=1S/C16H21N3O5S/c1-25(23,24)13-8-6-12(7-9-13)16(22)18-17-14(20)11-19-10-4-2-3-5-15(19)21/h6-9H,2-5,10-11H2,1H3,(H,17,20)(H,18,22) |
| InChIKey | FLQQOXBQPATWQF-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|