C21H23N3O5S — CID 142011693
N-[4-[[2-(2-oxoazepan-1-yl)acetyl]amino]phenyl]sulfonylbenzamide (PubChem CID 142011693) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[4-[[2-(2-oxoazepan-1-yl)acetyl]amino]phenyl]sulfonylbenzamide.
| Compound Name | N-[4-[[2-(2-oxoazepan-1-yl)acetyl]amino]phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 142011693 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-[4-[[2-(2-oxoazepan-1-yl)acetyl]amino]phenyl]sulfonylbenzamide |
| SMILES | O=C(CN1CCCCCC1=O)Nc1ccc(S(=O)(=O)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23N3O5S/c25-19(15-24-14-6-2-5-9-20(24)26)22-17-10-12-18(13-11-17)30(28,29)23-21(27)16-7-3-1-4-8-16/h1,3-4,7-8,10-13H,2,5-6,9,14-15H2,(H,22,25)(H,23,27) |
| InChIKey | XEZBLRBGGYQKID-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |