C21H22FN3O3 — CID 55887711
N-(3-fluorophenyl)-3-[[2-(2-oxoazepan-1-yl)acetyl]amino]benzamide (PubChem CID 55887711) has the molecular formula C21H22FN3O3 and a molecular weight of 383.42 g/mol. Its IUPAC name is N-(3-fluorophenyl)-3-[[2-(2-oxoazepan-1-yl)acetyl]amino]benzamide.
| Compound Name | N-(3-fluorophenyl)-3-[[2-(2-oxoazepan-1-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 55887711 |
| Molecular Formula | C21H22FN3O3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-(3-fluorophenyl)-3-[[2-(2-oxoazepan-1-yl)acetyl]amino]benzamide |
| SMILES | O=C(CN1CCCCCC1=O)Nc1cccc(C(=O)Nc2cccc(F)c2)c1 |
| InChI | InChI=1S/C21H22FN3O3/c22-16-7-5-9-18(13-16)24-21(28)15-6-4-8-17(12-15)23-19(26)14-25-11-3-1-2-10-20(25)27/h4-9,12-13H,1-3,10-11,14H2,(H,23,26)(H,24,28) |
| InChIKey | FCRBYKQXBFYYSC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |