C22H31N3O3 — CID 39515028
3-(cyclohexanecarbonylamino)-N-[2-(2-oxoazepan-1-yl)ethyl]benzamide (PubChem CID 39515028) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 3-(cyclohexanecarbonylamino)-N-[2-(2-oxoazepan-1-yl)ethyl]benzamide.
| Compound Name | 3-(cyclohexanecarbonylamino)-N-[2-(2-oxoazepan-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 39515028 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 3-(cyclohexanecarbonylamino)-N-[2-(2-oxoazepan-1-yl)ethyl]benzamide |
| SMILES | O=C(NCCN1CCCCCC1=O)c1cccc(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C22H31N3O3/c26-20-12-5-2-6-14-25(20)15-13-23-21(27)18-10-7-11-19(16-18)24-22(28)17-8-3-1-4-9-17/h7,10-11,16-17H,1-6,8-9,12-15H2,(H,23,27)(H,24,28) |
| InChIKey | DXEZXACTCLRFEH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |