C24H30N2O4 — CID 39899444
3-(cyclohexanecarbonylamino)-N-[2-(3,4-dimethoxyphenyl)ethyl]benzamide (PubChem CID 39899444) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 3-(cyclohexanecarbonylamino)-N-[2-(3,4-dimethoxyphenyl)ethyl]benzamide.
| Compound Name | 3-(cyclohexanecarbonylamino)-N-[2-(3,4-dimethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 39899444 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 3-(cyclohexanecarbonylamino)-N-[2-(3,4-dimethoxyphenyl)ethyl]benzamide |
| SMILES | COc1ccc(CCNC(=O)c2cccc(NC(=O)C3CCCCC3)c2)cc1OC |
| InChI | InChI=1S/C24H30N2O4/c1-29-21-12-11-17(15-22(21)30-2)13-14-25-23(27)19-9-6-10-20(16-19)26-24(28)18-7-4-3-5-8-18/h6,9-12,15-16,18H,3-5,7-8,13-14H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | FUGQEDQEDVCYRZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |