C25H32ClN3O2 — CID 42767064
3-chloro-N-[4-(4-octanoylpiperazin-1-yl)phenyl]benzamide (PubChem CID 42767064) has the molecular formula C25H32ClN3O2 and a molecular weight of 442.00 g/mol. Its IUPAC name is 3-chloro-N-[4-(4-octanoylpiperazin-1-yl)phenyl]benzamide.
| Compound Name | 3-chloro-N-[4-(4-octanoylpiperazin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 42767064 |
| Molecular Formula | C25H32ClN3O2 |
| Molecular Weight | 442.00 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 3-chloro-N-[4-(4-octanoylpiperazin-1-yl)phenyl]benzamide |
| SMILES | CCCCCCCC(=O)N1CCN(c2ccc(NC(=O)c3cccc(Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C25H32ClN3O2/c1-2-3-4-5-6-10-24(30)29-17-15-28(16-18-29)23-13-11-22(12-14-23)27-25(31)20-8-7-9-21(26)19-20/h7-9,11-14,19H,2-6,10,15-18H2,1H3,(H,27,31) |
| InChIKey | RSGOEXJPFQMXJB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.00 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|