C23H26F3N3O2 — CID 42767036
N-[4-(4-pentanoylpiperazin-1-yl)phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 42767036) has the molecular formula C23H26F3N3O2 and a molecular weight of 433.47 g/mol. Its IUPAC name is N-[4-(4-pentanoylpiperazin-1-yl)phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(4-pentanoylpiperazin-1-yl)phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 42767036 |
| Molecular Formula | C23H26F3N3O2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-[4-(4-pentanoylpiperazin-1-yl)phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | CCCCC(=O)N1CCN(c2ccc(NC(=O)c3cccc(C(F)(F)F)c3)cc2)CC1 |
| InChI | InChI=1S/C23H26F3N3O2/c1-2-3-7-21(30)29-14-12-28(13-15-29)20-10-8-19(9-11-20)27-22(31)17-5-4-6-18(16-17)23(24,25)26/h4-6,8-11,16H,2-3,7,12-15H2,1H3,(H,27,31) |
| InChIKey | HUJPVBVHVCPIHM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|