C25H30ClN5O — CID 42429096
2-(3-chlorophenyl)-N-[4-[4-(3-pyrazol-1-ylpropylamino)piperidin-1-yl]phenyl]acetamide (PubChem CID 42429096) has the molecular formula C25H30ClN5O and a molecular weight of 452.00 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[4-[4-(3-pyrazol-1-ylpropylamino)piperidin-1-yl]phenyl]acetamide.
| Compound Name | 2-(3-chlorophenyl)-N-[4-[4-(3-pyrazol-1-ylpropylamino)piperidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 42429096 |
| Molecular Formula | C25H30ClN5O |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[4-[4-(3-pyrazol-1-ylpropylamino)piperidin-1-yl]phenyl]acetamide |
| SMILES | O=C(Cc1cccc(Cl)c1)Nc1ccc(N2CCC(NCCCn3cccn3)CC2)cc1 |
| InChI | InChI=1S/C25H30ClN5O/c26-21-5-1-4-20(18-21)19-25(32)29-23-6-8-24(9-7-23)30-16-10-22(11-17-30)27-12-2-14-31-15-3-13-28-31/h1,3-9,13,15,18,22,27H,2,10-12,14,16-17,19H2,(H,29,32) |
| InChIKey | WYQNQRPUVBSXLW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|