C21H26ClN3O — CID 108991011
1-[2-(3-chlorophenyl)ethyl]-3-[4-(4-methylpiperidin-1-yl)phenyl]urea (PubChem CID 108991011) has the molecular formula C21H26ClN3O and a molecular weight of 371.91 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-[4-(4-methylpiperidin-1-yl)phenyl]urea.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-[4-(4-methylpiperidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 108991011 |
| Molecular Formula | C21H26ClN3O |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-[4-(4-methylpiperidin-1-yl)phenyl]urea |
| SMILES | CC1CCN(c2ccc(NC(=O)NCCc3cccc(Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C21H26ClN3O/c1-16-10-13-25(14-11-16)20-7-5-19(6-8-20)24-21(26)23-12-9-17-3-2-4-18(22)15-17/h2-8,15-16H,9-14H2,1H3,(H2,23,24,26) |
| InChIKey | HVMDDVVISOFARD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|