C24H27N5O3 — CID 26344393
N-[4-[4-(2-pyrazol-1-ylethylamino)piperidin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 26344393) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-[4-[4-(2-pyrazol-1-ylethylamino)piperidin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[4-[4-(2-pyrazol-1-ylethylamino)piperidin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 26344393 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | N-[4-[4-(2-pyrazol-1-ylethylamino)piperidin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCC(NCCn3cccn3)CC2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H27N5O3/c30-24(18-2-7-22-23(16-18)32-17-31-22)27-20-3-5-21(6-4-20)28-13-8-19(9-14-28)25-11-15-29-12-1-10-26-29/h1-7,10,12,16,19,25H,8-9,11,13-15,17H2,(H,27,30) |
| InChIKey | GUZNXWWQDHTRNI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|