C23H34N6O2 — CID 26340845
N-(2-morpholin-4-ylethyl)-4-[4-(2-pyrazol-1-ylethylamino)piperidin-1-yl]benzamide (PubChem CID 26340845) has the molecular formula C23H34N6O2 and a molecular weight of 426.57 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-4-[4-(2-pyrazol-1-ylethylamino)piperidin-1-yl]benzamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-4-[4-(2-pyrazol-1-ylethylamino)piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 26340845 |
| Molecular Formula | C23H34N6O2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-4-[4-(2-pyrazol-1-ylethylamino)piperidin-1-yl]benzamide |
| SMILES | O=C(NCCN1CCOCC1)c1ccc(N2CCC(NCCn3cccn3)CC2)cc1 |
| InChI | InChI=1S/C23H34N6O2/c30-23(25-9-14-27-16-18-31-19-17-27)20-2-4-22(5-3-20)28-12-6-21(7-13-28)24-10-15-29-11-1-8-26-29/h1-5,8,11,21,24H,6-7,9-10,12-19H2,(H,25,30) |
| InChIKey | MUWIEMRYUHEGDB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |