C29H31N3O3 — CID 42480111
N-[4-[4-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]piperidin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 42480111) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-[4-[4-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]piperidin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[4-[4-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]piperidin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 42480111 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | N-[4-[4-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]piperidin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCC(N[C@H]3CCCc4ccccc43)CC2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H31N3O3/c33-29(21-8-13-27-28(18-21)35-19-34-27)31-22-9-11-24(12-10-22)32-16-14-23(15-17-32)30-26-7-3-5-20-4-1-2-6-25(20)26/h1-2,4,6,8-13,18,23,26,30H,3,5,7,14-17,19H2,(H,31,33)/t26-/m0/s1 |
| InChIKey | DBMHSTXAMFXMKT-SANMLTNESA-N |
| XLogP | 5.30 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|