C27H34N4O5 — CID 25465200
ethyl 4-[[1-[4-(1,3-benzodioxole-5-carbonylamino)phenyl]piperidin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 25465200) has the molecular formula C27H34N4O5 and a molecular weight of 494.59 g/mol. Its IUPAC name is ethyl 4-[[1-[4-(1,3-benzodioxole-5-carbonylamino)phenyl]piperidin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[1-[4-(1,3-benzodioxole-5-carbonylamino)phenyl]piperidin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 25465200 |
| Molecular Formula | C27H34N4O5 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | ethyl 4-[[1-[4-(1,3-benzodioxole-5-carbonylamino)phenyl]piperidin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC2CCN(c3ccc(NC(=O)c4ccc5c(c4)OCO5)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H34N4O5/c1-2-34-27(33)31-15-11-22(12-16-31)28-21-9-13-30(14-10-21)23-6-4-20(5-7-23)29-26(32)19-3-8-24-25(17-19)36-18-35-24/h3-8,17,21-22,28H,2,9-16,18H2,1H3,(H,29,32) |
| InChIKey | SZDXHBXVPORXAO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|