C16H18N4O4 — CID 37393583
N-[2-oxo-2-(3-pyrazol-1-ylpropylamino)ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 37393583) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is N-[2-oxo-2-(3-pyrazol-1-ylpropylamino)ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-oxo-2-(3-pyrazol-1-ylpropylamino)ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 37393583 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | N-[2-oxo-2-(3-pyrazol-1-ylpropylamino)ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc2c(c1)OCO2)NCCCn1cccn1 |
| InChI | InChI=1S/C16H18N4O4/c21-15(17-5-1-7-20-8-2-6-19-20)10-18-16(22)12-3-4-13-14(9-12)24-11-23-13/h2-4,6,8-9H,1,5,7,10-11H2,(H,17,21)(H,18,22) |
| InChIKey | KEIOVPKSTWLLHX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|