C12H10N2O3 — CID 43798084
1-(1,3-benzodioxol-5-yl)-2-pyrazol-1-ylethanone (PubChem CID 43798084) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-pyrazol-1-ylethanone.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-pyrazol-1-ylethanone |
|---|---|
| PubChem CID | 43798084 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-pyrazol-1-ylethanone |
| SMILES | O=C(Cn1cccn1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H10N2O3/c15-10(7-14-5-1-4-13-14)9-2-3-11-12(6-9)17-8-16-11/h1-6H,7-8H2 |
| InChIKey | XXSOFYJUDTYABO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |