C15H16N2O4 — CID 80580043
1-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]-3-propylimidazol-2-one (PubChem CID 80580043) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]-3-propylimidazol-2-one.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]-3-propylimidazol-2-one |
|---|---|
| PubChem CID | 80580043 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl]-3-propylimidazol-2-one |
| SMILES | CCCn1ccn(CC(=O)c2ccc3c(c2)OCO3)c1=O |
| InChI | InChI=1S/C15H16N2O4/c1-2-5-16-6-7-17(15(16)19)9-12(18)11-3-4-13-14(8-11)21-10-20-13/h3-4,6-8H,2,5,9-10H2,1H3 |
| InChIKey | NYFJYZSLZKHBDC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |