C24H31ClN4O2 — CID 58867575
4-(4-chlorophenyl)-N-[4-[3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]phenyl]piperidine-1-carboxamide (PubChem CID 58867575) has the molecular formula C24H31ClN4O2 and a molecular weight of 442.99 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[4-[3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]phenyl]piperidine-1-carboxamide.
| Compound Name | 4-(4-chlorophenyl)-N-[4-[3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 58867575 |
| Molecular Formula | C24H31ClN4O2 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[4-[3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]phenyl]piperidine-1-carboxamide |
| SMILES | CN(C)C1CN(c2ccc(NC(=O)N3CCC(c4ccc(Cl)cc4)CC3)cc2)CC1O |
| InChI | InChI=1S/C24H31ClN4O2/c1-27(2)22-15-29(16-23(22)30)21-9-7-20(8-10-21)26-24(31)28-13-11-18(12-14-28)17-3-5-19(25)6-4-17/h3-10,18,22-23,30H,11-16H2,1-2H3,(H,26,31) |
| InChIKey | SZSTWPVJURRIPH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|