C24H29ClN4O3 — CID 91391170
[4-(4-chlorophenyl)piperidin-1-yl] N-[4-[3-[acetyl(methyl)amino]azetidin-1-yl]phenyl]carbamate (PubChem CID 91391170) has the molecular formula C24H29ClN4O3 and a molecular weight of 456.97 g/mol. Its IUPAC name is [4-(4-chlorophenyl)piperidin-1-yl] N-[4-[3-[acetyl(methyl)amino]azetidin-1-yl]phenyl]carbamate.
| Compound Name | [4-(4-chlorophenyl)piperidin-1-yl] N-[4-[3-[acetyl(methyl)amino]azetidin-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 91391170 |
| Molecular Formula | C24H29ClN4O3 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | [4-(4-chlorophenyl)piperidin-1-yl] N-[4-[3-[acetyl(methyl)amino]azetidin-1-yl]phenyl]carbamate |
| SMILES | CC(=O)N(C)C1CN(c2ccc(NC(=O)ON3CCC(c4ccc(Cl)cc4)CC3)cc2)C1 |
| InChI | InChI=1S/C24H29ClN4O3/c1-17(30)27(2)23-15-28(16-23)22-9-7-21(8-10-22)26-24(31)32-29-13-11-19(12-14-29)18-3-5-20(25)6-4-18/h3-10,19,23H,11-16H2,1-2H3,(H,26,31) |
| InChIKey | KQOQZXTXJIMMLQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|