C26H33ClN4O2 — CID 58867616
N-[4-[3-[acetyl(methyl)amino]pyrrolidin-1-yl]phenyl]-2-[4-(4-chlorophenyl)piperidin-1-yl]acetamide (PubChem CID 58867616) has the molecular formula C26H33ClN4O2 and a molecular weight of 469.03 g/mol. Its IUPAC name is N-[4-[3-[acetyl(methyl)amino]pyrrolidin-1-yl]phenyl]-2-[4-(4-chlorophenyl)piperidin-1-yl]acetamide.
| Compound Name | N-[4-[3-[acetyl(methyl)amino]pyrrolidin-1-yl]phenyl]-2-[4-(4-chlorophenyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 58867616 |
| Molecular Formula | C26H33ClN4O2 |
| Molecular Weight | 469.03 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | N-[4-[3-[acetyl(methyl)amino]pyrrolidin-1-yl]phenyl]-2-[4-(4-chlorophenyl)piperidin-1-yl]acetamide |
| SMILES | CC(=O)N(C)C1CCN(c2ccc(NC(=O)CN3CCC(c4ccc(Cl)cc4)CC3)cc2)C1 |
| InChI | InChI=1S/C26H33ClN4O2/c1-19(32)29(2)25-13-16-31(17-25)24-9-7-23(8-10-24)28-26(33)18-30-14-11-21(12-15-30)20-3-5-22(27)6-4-20/h3-10,21,25H,11-18H2,1-2H3,(H,28,33) |
| InChIKey | CSTCUOBESOVHEL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.03 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|