C19H28N4O3 — CID 91302941
[4-[3-[methyl-(2-piperidin-1-ylacetyl)amino]pyrrolidin-1-yl]phenyl]carbamic acid (PubChem CID 91302941) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is [4-[3-[methyl-(2-piperidin-1-ylacetyl)amino]pyrrolidin-1-yl]phenyl]carbamic acid.
| Compound Name | [4-[3-[methyl-(2-piperidin-1-ylacetyl)amino]pyrrolidin-1-yl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 91302941 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | [4-[3-[methyl-(2-piperidin-1-ylacetyl)amino]pyrrolidin-1-yl]phenyl]carbamic acid |
| SMILES | CN(C(=O)CN1CCCCC1)C1CCN(c2ccc(NC(=O)O)cc2)C1 |
| InChI | InChI=1S/C19H28N4O3/c1-21(18(24)14-22-10-3-2-4-11-22)17-9-12-23(13-17)16-7-5-15(6-8-16)20-19(25)26/h5-8,17,20H,2-4,9-14H2,1H3,(H,25,26) |
| InChIKey | YFMBZLDESOVXCA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|