C19H20F3N3O2 — CID 86988121
4-(2-hydroxyphenyl)-N-[4-methyl-3-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 86988121) has the molecular formula C19H20F3N3O2 and a molecular weight of 379.38 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)-N-[4-methyl-3-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-hydroxyphenyl)-N-[4-methyl-3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 86988121 |
| Molecular Formula | C19H20F3N3O2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 4-(2-hydroxyphenyl)-N-[4-methyl-3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCN(c3ccccc3O)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C19H20F3N3O2/c1-13-6-7-14(12-15(13)19(20,21)22)23-18(27)25-10-8-24(9-11-25)16-4-2-3-5-17(16)26/h2-7,12,26H,8-11H2,1H3,(H,23,27) |
| InChIKey | RKTAAYZIWBZDCP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |