C23H30ClN5O2 — CID 58867238
4-(5-chloro-2-pyridinyl)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-hydroxypiperidine-1-carboxamide (PubChem CID 58867238) has the molecular formula C23H30ClN5O2 and a molecular weight of 443.98 g/mol. Its IUPAC name is 4-(5-chloro-2-pyridinyl)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-hydroxypiperidine-1-carboxamide.
| Compound Name | 4-(5-chloro-2-pyridinyl)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-hydroxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 58867238 |
| Molecular Formula | C23H30ClN5O2 |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 4-(5-chloro-2-pyridinyl)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-hydroxypiperidine-1-carboxamide |
| SMILES | CN(C)C1CCN(c2ccc(NC(=O)N3CCC(O)(c4ccc(Cl)cn4)CC3)cc2)C1 |
| InChI | InChI=1S/C23H30ClN5O2/c1-27(2)20-9-12-29(16-20)19-6-4-18(5-7-19)26-22(30)28-13-10-23(31,11-14-28)21-8-3-17(24)15-25-21/h3-8,15,20,31H,9-14,16H2,1-2H3,(H,26,30) |
| InChIKey | XQKJWBUQEBWLHV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|