C23H26ClN5O — CID 70829641
N-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazole-5-carboxamide (PubChem CID 70829641) has the molecular formula C23H26ClN5O and a molecular weight of 423.95 g/mol. Its IUPAC name is N-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazole-5-carboxamide.
| Compound Name | N-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 70829641 |
| Molecular Formula | C23H26ClN5O |
| Molecular Weight | 423.95 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazole-5-carboxamide |
| SMILES | CN1C[C@@H]2CCN(c3ccc(NC(=O)C4CC(c5ccc(Cl)cc5)=NN4)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C23H26ClN5O/c1-28-13-16-10-11-29(22(16)14-28)19-8-6-18(7-9-19)25-23(30)21-12-20(26-27-21)15-2-4-17(24)5-3-15/h2-9,16,21-22,27H,10-14H2,1H3,(H,25,30)/t16-,21?,22+/m0/s1 |
| InChIKey | ALYNTKGOHJCCJW-GWGYHSHPSA-N |
| XLogP | 3.18 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.95 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |