C23H29ClN4O3S — CID 30331284
(3R)-1-(4-chlorophenyl)sulfonyl-N-[4-(4-methylpiperazin-1-yl)phenyl]piperidine-3-carboxamide (PubChem CID 30331284) has the molecular formula C23H29ClN4O3S and a molecular weight of 477.03 g/mol. Its IUPAC name is (3R)-1-(4-chlorophenyl)sulfonyl-N-[4-(4-methylpiperazin-1-yl)phenyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-(4-chlorophenyl)sulfonyl-N-[4-(4-methylpiperazin-1-yl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 30331284 |
| Molecular Formula | C23H29ClN4O3S |
| Molecular Weight | 477.03 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | (3R)-1-(4-chlorophenyl)sulfonyl-N-[4-(4-methylpiperazin-1-yl)phenyl]piperidine-3-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)[C@@H]3CCCN(S(=O)(=O)c4ccc(Cl)cc4)C3)cc2)CC1 |
| InChI | InChI=1S/C23H29ClN4O3S/c1-26-13-15-27(16-14-26)21-8-6-20(7-9-21)25-23(29)18-3-2-12-28(17-18)32(30,31)22-10-4-19(24)5-11-22/h4-11,18H,2-3,12-17H2,1H3,(H,25,29)/t18-/m1/s1 |
| InChIKey | QJIXOHXOWYUVPK-GOSISDBHSA-N |
| XLogP | 3.13 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.03 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|