C28H33ClN2O3S — CID 133189440
N-[4-(1-adamantyl)phenyl]-1-(4-chlorophenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 133189440) has the molecular formula C28H33ClN2O3S and a molecular weight of 513.10 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-1-(4-chlorophenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-[4-(1-adamantyl)phenyl]-1-(4-chlorophenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 133189440 |
| Molecular Formula | C28H33ClN2O3S |
| Molecular Weight | 513.10 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-1-(4-chlorophenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1)C1CCCN(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C28H33ClN2O3S/c29-24-5-9-26(10-6-24)35(33,34)31-11-1-2-22(18-31)27(32)30-25-7-3-23(4-8-25)28-15-19-12-20(16-28)14-21(13-19)17-28/h3-10,19-22H,1-2,11-18H2,(H,30,32) |
| InChIKey | SMSGWMSGEMZISY-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.10 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |