C30H38N2O3S — CID 92641489
(3S)-N-[4-(1-adamantyl)phenyl]-1-[(2-methylphenyl)methylsulfonyl]piperidine-3-carboxamide (PubChem CID 92641489) has the molecular formula C30H38N2O3S and a molecular weight of 506.71 g/mol. Its IUPAC name is (3S)-N-[4-(1-adamantyl)phenyl]-1-[(2-methylphenyl)methylsulfonyl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-[4-(1-adamantyl)phenyl]-1-[(2-methylphenyl)methylsulfonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92641489 |
| Molecular Formula | C30H38N2O3S |
| Molecular Weight | 506.71 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | (3S)-N-[4-(1-adamantyl)phenyl]-1-[(2-methylphenyl)methylsulfonyl]piperidine-3-carboxamide |
| SMILES | Cc1ccccc1CS(=O)(=O)N1CCC[C@H](C(=O)Nc2ccc(C34CC5CC(CC(C5)C3)C4)cc2)C1 |
| InChI | InChI=1S/C30H38N2O3S/c1-21-5-2-3-6-26(21)20-36(34,35)32-12-4-7-25(19-32)29(33)31-28-10-8-27(9-11-28)30-16-22-13-23(17-30)15-24(14-22)18-30/h2-3,5-6,8-11,22-25H,4,7,12-20H2,1H3,(H,31,33)/t22?,23?,24?,25-,30?/m0/s1 |
| InChIKey | AKVJWCXMOPJCDE-FVOFJTEKSA-N |
| XLogP | 5.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.71 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |