C28H34N2O3S — CID 100644610
N-[4-(1-adamantyl)phenyl]-1-(benzenesulfonyl)piperidine-4-carboxamide (PubChem CID 100644610) has the molecular formula C28H34N2O3S and a molecular weight of 478.66 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-1-(benzenesulfonyl)piperidine-4-carboxamide.
| Compound Name | N-[4-(1-adamantyl)phenyl]-1-(benzenesulfonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 100644610 |
| Molecular Formula | C28H34N2O3S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-1-(benzenesulfonyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1)C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H34N2O3S/c31-27(23-10-12-30(13-11-23)34(32,33)26-4-2-1-3-5-26)29-25-8-6-24(7-9-25)28-17-20-14-21(18-28)16-22(15-20)19-28/h1-9,20-23H,10-19H2,(H,29,31) |
| InChIKey | PUXZUUOOVLIVQX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |