C22H26N2O5S — CID 100798707
ethyl 2-[4-[[1-(benzenesulfonyl)piperidine-4-carbonyl]amino]phenyl]acetate (PubChem CID 100798707) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is ethyl 2-[4-[[1-(benzenesulfonyl)piperidine-4-carbonyl]amino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[[1-(benzenesulfonyl)piperidine-4-carbonyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 100798707 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | ethyl 2-[4-[[1-(benzenesulfonyl)piperidine-4-carbonyl]amino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(NC(=O)C2CCN(S(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H26N2O5S/c1-2-29-21(25)16-17-8-10-19(11-9-17)23-22(26)18-12-14-24(15-13-18)30(27,28)20-6-4-3-5-7-20/h3-11,18H,2,12-16H2,1H3,(H,23,26) |
| InChIKey | LDPMVYQHJCQPSI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |