C24H31N3O5S — CID 50822633
ethyl 2-[4-[2-[1-(benzenesulfonyl)piperidin-4-yl]ethylcarbamoylamino]phenyl]acetate (PubChem CID 50822633) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is ethyl 2-[4-[2-[1-(benzenesulfonyl)piperidin-4-yl]ethylcarbamoylamino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[2-[1-(benzenesulfonyl)piperidin-4-yl]ethylcarbamoylamino]phenyl]acetate |
|---|---|
| PubChem CID | 50822633 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | ethyl 2-[4-[2-[1-(benzenesulfonyl)piperidin-4-yl]ethylcarbamoylamino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(NC(=O)NCCC2CCN(S(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H31N3O5S/c1-2-32-23(28)18-20-8-10-21(11-9-20)26-24(29)25-15-12-19-13-16-27(17-14-19)33(30,31)22-6-4-3-5-7-22/h3-11,19H,2,12-18H2,1H3,(H2,25,26,29) |
| InChIKey | NBZBXFGSMSBXKB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |