C22H29N3O3S2 — CID 50822763
1-[2-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]ethyl]-3-(3-methylsulfanylphenyl)urea (PubChem CID 50822763) has the molecular formula C22H29N3O3S2 and a molecular weight of 447.63 g/mol. Its IUPAC name is 1-[2-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]ethyl]-3-(3-methylsulfanylphenyl)urea.
| Compound Name | 1-[2-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]ethyl]-3-(3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 50822763 |
| Molecular Formula | C22H29N3O3S2 |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 1-[2-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]ethyl]-3-(3-methylsulfanylphenyl)urea |
| SMILES | CSc1cccc(NC(=O)NCCC2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)c1 |
| InChI | InChI=1S/C22H29N3O3S2/c1-17-6-8-21(9-7-17)30(27,28)25-14-11-18(12-15-25)10-13-23-22(26)24-19-4-3-5-20(16-19)29-2/h3-9,16,18H,10-15H2,1-2H3,(H2,23,24,26) |
| InChIKey | XVYGLCDXSYFSDQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |