C21H26ClN3O3S — CID 50822700
1-[2-[1-(benzenesulfonyl)piperidin-4-yl]ethyl]-3-(3-chloro-4-methylphenyl)urea (PubChem CID 50822700) has the molecular formula C21H26ClN3O3S and a molecular weight of 435.98 g/mol. Its IUPAC name is 1-[2-[1-(benzenesulfonyl)piperidin-4-yl]ethyl]-3-(3-chloro-4-methylphenyl)urea.
| Compound Name | 1-[2-[1-(benzenesulfonyl)piperidin-4-yl]ethyl]-3-(3-chloro-4-methylphenyl)urea |
|---|---|
| PubChem CID | 50822700 |
| Molecular Formula | C21H26ClN3O3S |
| Molecular Weight | 435.98 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 1-[2-[1-(benzenesulfonyl)piperidin-4-yl]ethyl]-3-(3-chloro-4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NCCC2CCN(S(=O)(=O)c3ccccc3)CC2)cc1Cl |
| InChI | InChI=1S/C21H26ClN3O3S/c1-16-7-8-18(15-20(16)22)24-21(26)23-12-9-17-10-13-25(14-11-17)29(27,28)19-5-3-2-4-6-19/h2-8,15,17H,9-14H2,1H3,(H2,23,24,26) |
| InChIKey | INAYMKBTGNNJTM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.98 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |