C12H15FN2OS — CID 123534187
N-(4-fluorophenyl)-4-sulfanylpiperidine-1-carboxamide (PubChem CID 123534187) has the molecular formula C12H15FN2OS and a molecular weight of 254.33 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-sulfanylpiperidine-1-carboxamide.
| Compound Name | N-(4-fluorophenyl)-4-sulfanylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 123534187 |
| Molecular Formula | C12H15FN2OS |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | N-(4-fluorophenyl)-4-sulfanylpiperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)N1CCC(S)CC1 |
| InChI | InChI=1S/C12H15FN2OS/c13-9-1-3-10(4-2-9)14-12(16)15-7-5-11(17)6-8-15/h1-4,11,17H,5-8H2,(H,14,16) |
| InChIKey | KXPVKSGNGPSNKU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|