C14H20FN3O — CID 68909816
4-amino-N-(4-fluorophenyl)-3,5-dimethylpiperidine-1-carboxamide (PubChem CID 68909816) has the molecular formula C14H20FN3O and a molecular weight of 265.33 g/mol. Its IUPAC name is 4-amino-N-(4-fluorophenyl)-3,5-dimethylpiperidine-1-carboxamide.
| Compound Name | 4-amino-N-(4-fluorophenyl)-3,5-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 68909816 |
| Molecular Formula | C14H20FN3O |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 4-amino-N-(4-fluorophenyl)-3,5-dimethylpiperidine-1-carboxamide |
| SMILES | CC1CN(C(=O)Nc2ccc(F)cc2)CC(C)C1N |
| InChI | InChI=1S/C14H20FN3O/c1-9-7-18(8-10(2)13(9)16)14(19)17-12-5-3-11(15)4-6-12/h3-6,9-10,13H,7-8,16H2,1-2H3,(H,17,19) |
| InChIKey | UQBQNWFDJWNSGN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |