C16H22N2O2 — CID 95770882
(5aS,8aS)-N-(4-methylphenyl)-2,3,4,5a,6,7,8,8a-octahydrocyclopenta[b][1,4]oxazepine-5-carboxamide (PubChem CID 95770882) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is (5aS,8aS)-N-(4-methylphenyl)-2,3,4,5a,6,7,8,8a-octahydrocyclopenta[b][1,4]oxazepine-5-carboxamide.
| Compound Name | (5aS,8aS)-N-(4-methylphenyl)-2,3,4,5a,6,7,8,8a-octahydrocyclopenta[b][1,4]oxazepine-5-carboxamide |
|---|---|
| PubChem CID | 95770882 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (5aS,8aS)-N-(4-methylphenyl)-2,3,4,5a,6,7,8,8a-octahydrocyclopenta[b][1,4]oxazepine-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCCO[C@H]3CCC[C@@H]32)cc1 |
| InChI | InChI=1S/C16H22N2O2/c1-12-6-8-13(9-7-12)17-16(19)18-10-3-11-20-15-5-2-4-14(15)18/h6-9,14-15H,2-5,10-11H2,1H3,(H,17,19)/t14-,15-/m0/s1 |
| InChIKey | MWYACCSHLMIIKJ-GJZGRUSLSA-N |
| XLogP | 3.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |