C13H15Cl2N3O2 — CID 99818478
(2S)-1-N-(2,5-dichlorophenyl)-2-N-methylpyrrolidine-1,2-dicarboxamide (PubChem CID 99818478) has the molecular formula C13H15Cl2N3O2 and a molecular weight of 316.19 g/mol. Its IUPAC name is (2S)-1-N-(2,5-dichlorophenyl)-2-N-methylpyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-1-N-(2,5-dichlorophenyl)-2-N-methylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 99818478 |
| Molecular Formula | C13H15Cl2N3O2 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | (2S)-1-N-(2,5-dichlorophenyl)-2-N-methylpyrrolidine-1,2-dicarboxamide |
| SMILES | CNC(=O)[C@@H]1CCCN1C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H15Cl2N3O2/c1-16-12(19)11-3-2-6-18(11)13(20)17-10-7-8(14)4-5-9(10)15/h4-5,7,11H,2-3,6H2,1H3,(H,16,19)(H,17,20)/t11-/m0/s1 |
| InChIKey | LNPSEEGGEIQYCX-NSHDSACASA-N |
| XLogP | 2.74 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |