C15H15Cl2N3O2 — CID 100615611
(2R)-1-(2-cyanoacetyl)-N-(2,5-dichlorophenyl)piperidine-2-carboxamide (PubChem CID 100615611) has the molecular formula C15H15Cl2N3O2 and a molecular weight of 340.21 g/mol. Its IUPAC name is (2R)-1-(2-cyanoacetyl)-N-(2,5-dichlorophenyl)piperidine-2-carboxamide.
| Compound Name | (2R)-1-(2-cyanoacetyl)-N-(2,5-dichlorophenyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 100615611 |
| Molecular Formula | C15H15Cl2N3O2 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | (2R)-1-(2-cyanoacetyl)-N-(2,5-dichlorophenyl)piperidine-2-carboxamide |
| SMILES | N#CCC(=O)N1CCCC[C@@H]1C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H15Cl2N3O2/c16-10-4-5-11(17)12(9-10)19-15(22)13-3-1-2-8-20(13)14(21)6-7-18/h4-5,9,13H,1-3,6,8H2,(H,19,22)/t13-/m1/s1 |
| InChIKey | MUAPHVZDKIKGMG-CYBMUJFWSA-N |
| XLogP | 3.23 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |