C22H25Cl2N3O4S — CID 52910121
(2S)-N-(2,5-dichlorophenyl)-1-[3-(propan-2-ylsulfamoyl)benzoyl]piperidine-2-carboxamide (PubChem CID 52910121) has the molecular formula C22H25Cl2N3O4S and a molecular weight of 498.43 g/mol. Its IUPAC name is (2S)-N-(2,5-dichlorophenyl)-1-[3-(propan-2-ylsulfamoyl)benzoyl]piperidine-2-carboxamide.
| Compound Name | (2S)-N-(2,5-dichlorophenyl)-1-[3-(propan-2-ylsulfamoyl)benzoyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 52910121 |
| Molecular Formula | C22H25Cl2N3O4S |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | (2S)-N-(2,5-dichlorophenyl)-1-[3-(propan-2-ylsulfamoyl)benzoyl]piperidine-2-carboxamide |
| SMILES | CC(C)NS(=O)(=O)c1cccc(C(=O)N2CCCC[C@H]2C(=O)Nc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C22H25Cl2N3O4S/c1-14(2)26-32(30,31)17-7-5-6-15(12-17)22(29)27-11-4-3-8-20(27)21(28)25-19-13-16(23)9-10-18(19)24/h5-7,9-10,12-14,20,26H,3-4,8,11H2,1-2H3,(H,25,28)/t20-/m0/s1 |
| InChIKey | IDHXARLLTPQWNP-FQEVSTJZSA-N |
| XLogP | 4.31 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |