C13H15ClF3N3O — CID 165430437
N-[2-chloro-5-(trifluoromethyl)phenyl]-3-methylpiperazine-1-carboxamide (PubChem CID 165430437) has the molecular formula C13H15ClF3N3O and a molecular weight of 321.73 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-3-methylpiperazine-1-carboxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-3-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 165430437 |
| Molecular Formula | C13H15ClF3N3O |
| Molecular Weight | 321.73 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-3-methylpiperazine-1-carboxamide |
| SMILES | CC1CN(C(=O)Nc2cc(C(F)(F)F)ccc2Cl)CCN1 |
| InChI | InChI=1S/C13H15ClF3N3O/c1-8-7-20(5-4-18-8)12(21)19-11-6-9(13(15,16)17)2-3-10(11)14/h2-3,6,8,18H,4-5,7H2,1H3,(H,19,21) |
| InChIKey | ZDSFQKHQFIYHKE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.73 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |