C17H21ClF3N3O2 — CID 108960805
N-[2-chloro-5-(trifluoromethyl)phenyl]-2,2-dimethyl-3-(4-methylpiperazin-1-yl)-3-oxopropanamide (PubChem CID 108960805) has the molecular formula C17H21ClF3N3O2 and a molecular weight of 391.82 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2,2-dimethyl-3-(4-methylpiperazin-1-yl)-3-oxopropanamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2,2-dimethyl-3-(4-methylpiperazin-1-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108960805 |
| Molecular Formula | C17H21ClF3N3O2 |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2,2-dimethyl-3-(4-methylpiperazin-1-yl)-3-oxopropanamide |
| SMILES | CN1CCN(C(=O)C(C)(C)C(=O)Nc2cc(C(F)(F)F)ccc2Cl)CC1 |
| InChI | InChI=1S/C17H21ClF3N3O2/c1-16(2,15(26)24-8-6-23(3)7-9-24)14(25)22-13-10-11(17(19,20)21)4-5-12(13)18/h4-5,10H,6-9H2,1-3H3,(H,22,25) |
| InChIKey | DMUMEXDKCDVXIS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|