C12H4ClF12NO — CID 5123869
N-[2-chloro-5-(trifluoromethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentanamide (PubChem CID 5123869) has the molecular formula C12H4ClF12NO and a molecular weight of 441.60 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentanamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentanamide |
|---|---|
| PubChem CID | 5123869 |
| Molecular Formula | C12H4ClF12NO |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentanamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H4ClF12NO/c13-5-2-1-4(9(16,17)18)3-6(5)26-7(27)8(14,15)10(19,20)11(21,22)12(23,24)25/h1-3H,(H,26,27) |
| InChIKey | NBONRTKPDUPYIF-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|