C13H12ClF3N2O2 — CID 108984030
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-oxo-2-pyrrolidin-1-ylacetamide (PubChem CID 108984030) has the molecular formula C13H12ClF3N2O2 and a molecular weight of 320.70 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-oxo-2-pyrrolidin-1-ylacetamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-oxo-2-pyrrolidin-1-ylacetamide |
|---|---|
| PubChem CID | 108984030 |
| Molecular Formula | C13H12ClF3N2O2 |
| Molecular Weight | 320.70 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-oxo-2-pyrrolidin-1-ylacetamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)C(=O)N1CCCC1 |
| InChI | InChI=1S/C13H12ClF3N2O2/c14-9-4-3-8(13(15,16)17)7-10(9)18-11(20)12(21)19-5-1-2-6-19/h3-4,7H,1-2,5-6H2,(H,18,20) |
| InChIKey | JNZPTDKWKSRXRU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.70 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|