C14H17ClF3N3O — CID 165430451
(3S)-3-(aminomethyl)-N-[2-chloro-5-(trifluoromethyl)phenyl]piperidine-1-carboxamide (PubChem CID 165430451) has the molecular formula C14H17ClF3N3O and a molecular weight of 335.76 g/mol. Its IUPAC name is (3S)-3-(aminomethyl)-N-[2-chloro-5-(trifluoromethyl)phenyl]piperidine-1-carboxamide.
| Compound Name | (3S)-3-(aminomethyl)-N-[2-chloro-5-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 165430451 |
| Molecular Formula | C14H17ClF3N3O |
| Molecular Weight | 335.76 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | (3S)-3-(aminomethyl)-N-[2-chloro-5-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
| SMILES | NC[C@@H]1CCCN(C(=O)Nc2cc(C(F)(F)F)ccc2Cl)C1 |
| InChI | InChI=1S/C14H17ClF3N3O/c15-11-4-3-10(14(16,17)18)6-12(11)20-13(22)21-5-1-2-9(7-19)8-21/h3-4,6,9H,1-2,5,7-8,19H2,(H,20,22)/t9-/m0/s1 |
| InChIKey | IBBQOQBSYAFUBW-VIFPVBQESA-N |
| XLogP | 3.56 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.76 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |