C13H13ClF3N3O2 — CID 108988628
N-[2-chloro-5-(trifluoromethyl)phenyl]-4-formylpiperazine-1-carboxamide (PubChem CID 108988628) has the molecular formula C13H13ClF3N3O2 and a molecular weight of 335.71 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-4-formylpiperazine-1-carboxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-4-formylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 108988628 |
| Molecular Formula | C13H13ClF3N3O2 |
| Molecular Weight | 335.71 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-4-formylpiperazine-1-carboxamide |
| SMILES | O=CN1CCN(C(=O)Nc2cc(C(F)(F)F)ccc2Cl)CC1 |
| InChI | InChI=1S/C13H13ClF3N3O2/c14-10-2-1-9(13(15,16)17)7-11(10)18-12(22)20-5-3-19(8-21)4-6-20/h1-2,7-8H,3-6H2,(H,18,22) |
| InChIKey | FVMMHOQNXFWWLR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.71 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|