C20H12ClF3N2OS — CID 19916626
N-[2-chloro-5-(trifluoromethyl)phenyl]phenothiazine-10-carboxamide (PubChem CID 19916626) has the molecular formula C20H12ClF3N2OS and a molecular weight of 420.84 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]phenothiazine-10-carboxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]phenothiazine-10-carboxamide |
|---|---|
| PubChem CID | 19916626 |
| Molecular Formula | C20H12ClF3N2OS |
| Molecular Weight | 420.84 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]phenothiazine-10-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C20H12ClF3N2OS/c21-13-10-9-12(20(22,23)24)11-14(13)25-19(27)26-15-5-1-3-7-17(15)28-18-8-4-2-6-16(18)26/h1-11H,(H,25,27) |
| InChIKey | VYKBAXQSVMRSOI-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.84 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |