C16H14ClF3N2OS — CID 146050838
3-amino-1-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-one;hydrochloride (PubChem CID 146050838) has the molecular formula C16H14ClF3N2OS and a molecular weight of 374.82 g/mol. Its IUPAC name is 3-amino-1-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-one;hydrochloride.
| Compound Name | 3-amino-1-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 146050838 |
| Molecular Formula | C16H14ClF3N2OS |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 3-amino-1-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-one;hydrochloride |
| SMILES | Cl.NCCC(=O)N1c2ccccc2Sc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C16H13F3N2OS.ClH/c17-16(18,19)10-5-6-14-12(9-10)21(15(22)7-8-20)11-3-1-2-4-13(11)23-14;/h1-6,9H,7-8,20H2;1H |
| InChIKey | ORFXBMHQSIJXTC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |