C15H14Cl2N2OS — CID 24747135
3-amino-1-(2-chlorophenothiazin-10-yl)propan-1-one;hydrochloride (PubChem CID 24747135) has the molecular formula C15H14Cl2N2OS and a molecular weight of 341.26 g/mol. Its IUPAC name is 3-amino-1-(2-chlorophenothiazin-10-yl)propan-1-one;hydrochloride.
| Compound Name | 3-amino-1-(2-chlorophenothiazin-10-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 24747135 |
| Molecular Formula | C15H14Cl2N2OS |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 3-amino-1-(2-chlorophenothiazin-10-yl)propan-1-one;hydrochloride |
| SMILES | Cl.NCCC(=O)N1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H13ClN2OS.ClH/c16-10-5-6-14-12(9-10)18(15(19)7-8-17)11-3-1-2-4-13(11)20-14;/h1-6,9H,7-8,17H2;1H |
| InChIKey | KDSXWWCQDZGHOO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |