C19H19ClN2O2S — CID 1304402
1-(2-chlorophenothiazin-10-yl)-3-morpholin-4-ylpropan-1-one (PubChem CID 1304402) has the molecular formula C19H19ClN2O2S and a molecular weight of 374.89 g/mol. Its IUPAC name is 1-(2-chlorophenothiazin-10-yl)-3-morpholin-4-ylpropan-1-one.
| Compound Name | 1-(2-chlorophenothiazin-10-yl)-3-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 1304402 |
| Molecular Formula | C19H19ClN2O2S |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 1-(2-chlorophenothiazin-10-yl)-3-morpholin-4-ylpropan-1-one |
| SMILES | O=C(CCN1CCOCC1)N1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H19ClN2O2S/c20-14-5-6-18-16(13-14)22(15-3-1-2-4-17(15)25-18)19(23)7-8-21-9-11-24-12-10-21/h1-6,13H,7-12H2 |
| InChIKey | VQRBPTSGZJXJBC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |